C21H34O2Si — CID 10860936
(1S,2R,5R,6R,7R)-5-[4-[tert-butyl(dimethyl)silyl]oxybut-1-en-2-yl]-4-methyltricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 10860936) has the molecular formula C21H34O2Si and a molecular weight of 346.59 g/mol. Its IUPAC name is (1S,2R,5R,6R,7R)-5-[4-[tert-butyl(dimethyl)silyl]oxybut-1-en-2-yl]-4-methyltricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2R,5R,6R,7R)-5-[4-[tert-butyl(dimethyl)silyl]oxybut-1-en-2-yl]-4-methyltricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 10860936 |
| Molecular Formula | C21H34O2Si |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (1S,2R,5R,6R,7R)-5-[4-[tert-butyl(dimethyl)silyl]oxybut-1-en-2-yl]-4-methyltricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | C=C(CCO[Si](C)(C)C(C)(C)C)[C@H]1C(C)C(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C21H34O2Si/c1-13(10-11-23-24(6,7)21(3,4)5)17-14(2)20(22)19-16-9-8-15(12-16)18(17)19/h8-9,14-19H,1,10-12H2,2-7H3/t14?,15-,16+,17-,18+,19+/m0/s1 |
| InChIKey | MWJPRIJFMOLAPC-CFIQQJQHSA-N |
| XLogP | 5.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|