About tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide
tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide (PubChem CID 10861081) has the molecular formula C14H26INO
and a molecular weight of 351.27 g/mol. Its IUPAC name is tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide.
Molecular Properties
| Compound Name | tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide |
| PubChem CID | 10861081 |
| Molecular Formula | C14H26INO |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide |
| SMILES | CCOC1=C/C(=[NH+]\C(C)(C)C)CC(C)(C)C1.[I-] |
| InChI | InChI=1S/C14H25NO.HI/c1-7-16-12-8-11(15-13(2,3)4)9-14(5,6)10-12;/h8H,7,9-10H2,1-6H3;1H/b15-11+; |
| InChIKey | YZNVBDNUCSRCMH-KRWCAOSLSA-N |
| XLogP | -0.95 |
| TPSA | 23.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide?
The IUPAC name of tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide (CID 10861081) is tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide.
What is the SMILES notation for tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide?
The canonical SMILES for tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide is CCOC1=C/C(=[NH+]\C(C)(C)C)CC(C)(C)C1.[I-].
What is the InChIKey of tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide?
The InChIKey is YZNVBDNUCSRCMH-KRWCAOSLSA-N. The full InChI is InChI=1S/C14H25NO.HI/c1-7-16-12-8-11(15-13(2,3)4)9-14(5,6)10-12;/h8H,7,9-10H2,1-6H3;1H/b15-11+;.
What are the key properties of tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide?
tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide has a molecular weight of 351.27 g/mol, XLogP of -0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium iodide is sourced from PubChem (CID 10861081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).