About N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine
N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine (PubChem CID 10861082) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine.
Molecular Properties
| Compound Name | N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine |
| PubChem CID | 10861082 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine |
| SMILES | CCOC1=C/C(=N\C(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H25NO/c1-7-16-12-8-11(15-13(2,3)4)9-14(5,6)10-12/h8H,7,9-10H2,1-6H3/b15-11+ |
| InChIKey | IKOOIDGXOVGMRJ-RVDMUPIBSA-N |
| XLogP | 3.97 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine?
The IUPAC name of N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine (CID 10861082) is N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine.
What is the SMILES notation for N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine?
The canonical SMILES for N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine is CCOC1=C/C(=N\C(C)(C)C)CC(C)(C)C1.
What is the InChIKey of N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine?
The InChIKey is IKOOIDGXOVGMRJ-RVDMUPIBSA-N. The full InChI is InChI=1S/C14H25NO/c1-7-16-12-8-11(15-13(2,3)4)9-14(5,6)10-12/h8H,7,9-10H2,1-6H3/b15-11+.
What are the key properties of N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine?
N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine has a molecular weight of 223.36 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-ethoxy-5,5-dimethylcyclohex-2-en-1-imine is sourced from PubChem (CID 10861082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).