C20H23NO4S2 — CID 108610852
4-hydroxy-2-(3-methylthiophen-2-yl)-1-(3-propan-2-yloxypropyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 108610852) has the molecular formula C20H23NO4S2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-hydroxy-2-(3-methylthiophen-2-yl)-1-(3-propan-2-yloxypropyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(3-methylthiophen-2-yl)-1-(3-propan-2-yloxypropyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108610852 |
| Molecular Formula | C20H23NO4S2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 4-hydroxy-2-(3-methylthiophen-2-yl)-1-(3-propan-2-yloxypropyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | Cc1ccsc1C1C(C(=O)c2cccs2)=C(O)C(=O)N1CCCOC(C)C |
| InChI | InChI=1S/C20H23NO4S2/c1-12(2)25-9-5-8-21-16(19-13(3)7-11-27-19)15(18(23)20(21)24)17(22)14-6-4-10-26-14/h4,6-7,10-12,16,23H,5,8-9H2,1-3H3 |
| InChIKey | GFFDSPKJDMHQGK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|