C8H2F10S2 — CID 10861103
3,6-bis(1,1,2,2,2-pentafluoroethyl)dithiine (PubChem CID 10861103) has the molecular formula C8H2F10S2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 3,6-bis(1,1,2,2,2-pentafluoroethyl)dithiine.
| Compound Name | 3,6-bis(1,1,2,2,2-pentafluoroethyl)dithiine |
|---|---|
| PubChem CID | 10861103 |
| Molecular Formula | C8H2F10S2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | 3,6-bis(1,1,2,2,2-pentafluoroethyl)dithiine |
| SMILES | FC(F)(F)C(F)(F)C1=CC=C(C(F)(F)C(F)(F)F)SS1 |
| InChI | InChI=1S/C8H2F10S2/c9-5(10,7(13,14)15)3-1-2-4(20-19-3)6(11,12)8(16,17)18/h1-2H |
| InChIKey | XDNCITINVHECJQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|