C20H20N2O4 — CID 10861113
N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 10861113) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 10861113 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | COc1ccc(C(C)NC(=O)C(=O)c2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C20H20N2O4/c1-12(13-8-9-17(25-2)18(10-13)26-3)22-20(24)19(23)15-11-21-16-7-5-4-6-14(15)16/h4-12,21H,1-3H3,(H,22,24) |
| InChIKey | FVZAOOBWDJAZSH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|