C24H25ClN2O6 — CID 108611165
[4-[(3E)-3-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108611165) has the molecular formula C24H25ClN2O6 and a molecular weight of 472.93 g/mol. Its IUPAC name is [4-[(3E)-3-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3E)-3-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108611165 |
| Molecular Formula | C24H25ClN2O6 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [4-[(3E)-3-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | COc1ccc(Cl)c(/C(O)=C2\C(=O)C(=O)N(CCN(C)C)C2c2ccc(OC(C)=O)cc2)c1 |
| InChI | InChI=1S/C24H25ClN2O6/c1-14(28)33-16-7-5-15(6-8-16)21-20(23(30)24(31)27(21)12-11-26(2)3)22(29)18-13-17(32-4)9-10-19(18)25/h5-10,13,21,29H,11-12H2,1-4H3/b22-20+ |
| InChIKey | IMQDLRKYUMDBTH-LSDHQDQOSA-N |
| XLogP | 3.26 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|