About [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate
[(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate (PubChem CID 10861187) has the molecular formula C18H33NO4Si
and a molecular weight of 355.55 g/mol. Its IUPAC name is [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate.
Molecular Properties
| Compound Name | [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate |
| PubChem CID | 10861187 |
| Molecular Formula | C18H33NO4Si |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O[C@H](C1=CCCC12OCCO2)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C18H33NO4Si/c1-13(2)19(14(3)4)17(20)23-16(24(5,6)7)15-9-8-10-18(15)21-11-12-22-18/h9,13-14,16H,8,10-12H2,1-7H3/t16-/m0/s1 |
| InChIKey | JLGLZCDWUCQGCB-INIZCTEOSA-N |
| XLogP | 3.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate?
The IUPAC name of [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate (CID 10861187) is [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate.
What is the SMILES notation for [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate?
The canonical SMILES for [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate is CC(C)N(C(=O)O[C@H](C1=CCCC12OCCO2)[Si](C)(C)C)C(C)C.
What is the InChIKey of [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate?
The InChIKey is JLGLZCDWUCQGCB-INIZCTEOSA-N. The full InChI is InChI=1S/C18H33NO4Si/c1-13(2)19(14(3)4)17(20)23-16(24(5,6)7)15-9-8-10-18(15)21-11-12-22-18/h9,13-14,16H,8,10-12H2,1-7H3/t16-/m0/s1.
What are the key properties of [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate?
[(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate has a molecular weight of 355.55 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(S)-1,4-dioxaspiro[4.4]non-8-en-9-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate is sourced from PubChem (CID 10861187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).