C19H26F3NO2 — CID 10861242
N-[(1R,2R)-1-[(3S)-2,2-dimethylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 10861242) has the molecular formula C19H26F3NO2 and a molecular weight of 357.42 g/mol. Its IUPAC name is N-[(1R,2R)-1-[(3S)-2,2-dimethylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R,2R)-1-[(3S)-2,2-dimethylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10861242 |
| Molecular Formula | C19H26F3NO2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[(1R,2R)-1-[(3S)-2,2-dimethylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C=CC[C@H](O[C@H](c1ccccc1)[C@@H](C)NC(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C19H26F3NO2/c1-6-10-15(18(3,4)5)25-16(14-11-8-7-9-12-14)13(2)23-17(24)19(20,21)22/h6-9,11-13,15-16H,1,10H2,2-5H3,(H,23,24)/t13-,15+,16+/m1/s1 |
| InChIKey | LAPPMKIAYJBNHP-KBMXLJTQSA-N |
| XLogP | 4.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|