C20H25NO5 — CID 10861289
methyl (1S,15S,18R,19S,20S)-18-hydroxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxylate (PubChem CID 10861289) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is methyl (1S,15S,18R,19S,20S)-18-hydroxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxylate.
| Compound Name | methyl (1S,15S,18R,19S,20S)-18-hydroxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxylate |
|---|---|
| PubChem CID | 10861289 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | methyl (1S,15S,18R,19S,20S)-18-hydroxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-triene-19-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C[C@H]3c4cc5c(cc4CCN3C[C@H]2CC[C@H]1O)OCO5 |
| InChI | InChI=1S/C20H25NO5/c1-24-20(23)19-14-7-15-13-8-18-17(25-10-26-18)6-11(13)4-5-21(15)9-12(14)2-3-16(19)22/h6,8,12,14-16,19,22H,2-5,7,9-10H2,1H3/t12-,14+,15+,16-,19+/m1/s1 |
| InChIKey | VNSOQQZNVNIEMP-GHTRYYNOSA-N |
| XLogP | 1.89 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |