C19H40O4Si — CID 10861332
tert-butyl (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethylheptanoate (PubChem CID 10861332) has the molecular formula C19H40O4Si and a molecular weight of 360.61 g/mol. Its IUPAC name is tert-butyl (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethylheptanoate.
| Compound Name | tert-butyl (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethylheptanoate |
|---|---|
| PubChem CID | 10861332 |
| Molecular Formula | C19H40O4Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | tert-butyl (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,6-dimethylheptanoate |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H40O4Si/c1-13(2)17(23-24(10,11)19(7,8)9)14(3)15(20)12-16(21)22-18(4,5)6/h13-15,17,20H,12H2,1-11H3/t14-,15+,17+/m0/s1 |
| InChIKey | IIQPRKMCCHBWEC-ZMSDIMECSA-N |
| XLogP | 4.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|