C23H25NO3 — CID 10861407
benzyl (2S,3aR,7aR)-1-benzyl-6-oxo-3,3a,4,5,7,7a-hexahydro-2H-indole-2-carboxylate (PubChem CID 10861407) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is benzyl (2S,3aR,7aR)-1-benzyl-6-oxo-3,3a,4,5,7,7a-hexahydro-2H-indole-2-carboxylate.
| Compound Name | benzyl (2S,3aR,7aR)-1-benzyl-6-oxo-3,3a,4,5,7,7a-hexahydro-2H-indole-2-carboxylate |
|---|---|
| PubChem CID | 10861407 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | benzyl (2S,3aR,7aR)-1-benzyl-6-oxo-3,3a,4,5,7,7a-hexahydro-2H-indole-2-carboxylate |
| SMILES | O=C1CC[C@@H]2C[C@@H](C(=O)OCc3ccccc3)N(Cc3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C23H25NO3/c25-20-12-11-19-13-22(23(26)27-16-18-9-5-2-6-10-18)24(21(19)14-20)15-17-7-3-1-4-8-17/h1-10,19,21-22H,11-16H2/t19-,21-,22+/m1/s1 |
| InChIKey | NZZOYIBQDBXYNF-FCEUIQTBSA-N |
| XLogP | 3.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |