C25H25Cl2NO6 — CID 108615109
(4E)-1-cyclopentyl-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108615109) has the molecular formula C25H25Cl2NO6 and a molecular weight of 506.38 g/mol. Its IUPAC name is (4E)-1-cyclopentyl-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-cyclopentyl-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108615109 |
| Molecular Formula | C25H25Cl2NO6 |
| Molecular Weight | 506.38 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | (4E)-1-cyclopentyl-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccccc1C1/C(=C(\O)c2cc(Cl)c(OC)c(Cl)c2OC)C(=O)C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C25H25Cl2NO6/c1-32-17-11-7-6-10-14(17)20-18(22(30)25(31)28(20)13-8-4-5-9-13)21(29)15-12-16(26)24(34-3)19(27)23(15)33-2/h6-7,10-13,20,29H,4-5,8-9H2,1-3H3/b21-18+ |
| InChIKey | VXXJSBPNGACMKC-DYTRJAOYSA-N |
| XLogP | 5.38 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|