C25H21ClN2O6 — CID 108617118
(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(pyridin-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108617118) has the molecular formula C25H21ClN2O6 and a molecular weight of 480.90 g/mol. Its IUPAC name is (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(pyridin-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(pyridin-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108617118 |
| Molecular Formula | C25H21ClN2O6 |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(pyridin-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(OC)c(/C(O)=C2\C(=O)C(=O)N(Cc3ccccn3)C2c2ccc(O)cc2)cc1Cl |
| InChI | InChI=1S/C25H21ClN2O6/c1-33-19-12-20(34-2)18(26)11-17(19)23(30)21-22(14-6-8-16(29)9-7-14)28(25(32)24(21)31)13-15-5-3-4-10-27-15/h3-12,22,29-30H,13H2,1-2H3/b23-21+ |
| InChIKey | YJZYKUBHVSDGMG-XTQSDGFTSA-N |
| XLogP | 4.08 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|