C20H18FNO3 — CID 108618551
1-(3-fluorophenyl)-4-hydroxy-2-(3-methylphenyl)-3-propanoyl-2H-pyrrol-5-one (PubChem CID 108618551) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4-hydroxy-2-(3-methylphenyl)-3-propanoyl-2H-pyrrol-5-one.
| Compound Name | 1-(3-fluorophenyl)-4-hydroxy-2-(3-methylphenyl)-3-propanoyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108618551 |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-(3-fluorophenyl)-4-hydroxy-2-(3-methylphenyl)-3-propanoyl-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(c2cccc(F)c2)C1c1cccc(C)c1 |
| InChI | InChI=1S/C20H18FNO3/c1-3-16(23)17-18(13-7-4-6-12(2)10-13)22(20(25)19(17)24)15-9-5-8-14(21)11-15/h4-11,18,24H,3H2,1-2H3 |
| InChIKey | BCMXKESZDDIQTQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |