C26H39NO — CID 10861857
4-[[(5R,8S,9S,10S,13R,14S,16R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]methylamino]phenol (PubChem CID 10861857) has the molecular formula C26H39NO and a molecular weight of 381.60 g/mol. Its IUPAC name is 4-[[(5R,8S,9S,10S,13R,14S,16R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]methylamino]phenol.
| Compound Name | 4-[[(5R,8S,9S,10S,13R,14S,16R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]methylamino]phenol |
|---|---|
| PubChem CID | 10861857 |
| Molecular Formula | C26H39NO |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | 4-[[(5R,8S,9S,10S,13R,14S,16R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl]methylamino]phenol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@H]4CCCC[C@@]43C)[C@@H]1C[C@@H](CNc1ccc(O)cc1)C2 |
| InChI | InChI=1S/C26H39NO/c1-25-14-12-23-22(11-6-19-5-3-4-13-26(19,23)2)24(25)15-18(16-25)17-27-20-7-9-21(28)10-8-20/h7-10,18-19,22-24,27-28H,3-6,11-17H2,1-2H3/t18-,19-,22-,23+,24+,25-,26+/m1/s1 |
| InChIKey | KKKVWVOWZFTVKJ-RXNJEGTLSA-N |
| XLogP | 6.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|