C25H17BrN2O3 — CID 108619052
4-[(3Z)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108619052) has the molecular formula C25H17BrN2O3 and a molecular weight of 473.33 g/mol. Its IUPAC name is 4-[(3Z)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3Z)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108619052 |
| Molecular Formula | C25H17BrN2O3 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 4-[(3Z)-3-[(4-bromophenyl)-hydroxymethylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | Cc1cccc(C2/C(=C(/O)c3ccc(Br)cc3)C(=O)C(=O)N2c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C25H17BrN2O3/c1-15-3-2-4-18(13-15)22-21(23(29)17-7-9-19(26)10-8-17)24(30)25(31)28(22)20-11-5-16(14-27)6-12-20/h2-13,22,29H,1H3/b23-21- |
| InChIKey | ZHLRUUYDUSWPCD-LNVKXUELSA-N |
| XLogP | 5.26 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|