C21H21NO5 — CID 108619251
3-(furan-2-carbonyl)-4-hydroxy-2-(3-methylphenyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one (PubChem CID 108619251) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-4-hydroxy-2-(3-methylphenyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(3-methylphenyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108619251 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(3-methylphenyl)-1-(oxolan-2-ylmethyl)-2H-pyrrol-5-one |
| SMILES | Cc1cccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2CC2CCCO2)c1 |
| InChI | InChI=1S/C21H21NO5/c1-13-5-2-6-14(11-13)18-17(19(23)16-8-4-10-27-16)20(24)21(25)22(18)12-15-7-3-9-26-15/h2,4-6,8,10-11,15,18,24H,3,7,9,12H2,1H3 |
| InChIKey | NUHHPAORAPQYMH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |