C25H28N2O4 — CID 108619957
(4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108619957) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108619957 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(C2/C(=C(/O)c3ccc4c(c3)CCCO4)C(=O)C(=O)N2CCN(C)C)c1 |
| InChI | InChI=1S/C25H28N2O4/c1-16-6-4-7-18(14-16)22-21(24(29)25(30)27(22)12-11-26(2)3)23(28)19-9-10-20-17(15-19)8-5-13-31-20/h4,6-7,9-10,14-15,22,28H,5,8,11-13H2,1-3H3/b23-21- |
| InChIKey | DWHMWZIIWITVRX-LNVKXUELSA-N |
| XLogP | 3.30 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|