About tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate
tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate (PubChem CID 10862018) has the molecular formula C21H25NO4S
and a molecular weight of 387.50 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate |
| PubChem CID | 10862018 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/S(=O)(=O)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO4S/c1-21(2,3)26-20(23)22-18(16-17-10-6-4-7-11-17)14-15-27(24,25)19-12-8-5-9-13-19/h4-15,18H,16H2,1-3H3,(H,22,23)/b15-14+/t18-/m1/s1 |
| InChIKey | IUUMZWSXOGEILR-LGHUBQEGSA-N |
| XLogP | 4.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate (CID 10862018) is tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate is CC(C)(C)OC(=O)N[C@H](/C=C/S(=O)(=O)c1ccccc1)Cc1ccccc1.
What is the InChIKey of tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate?
The InChIKey is IUUMZWSXOGEILR-LGHUBQEGSA-N. The full InChI is InChI=1S/C21H25NO4S/c1-21(2,3)26-20(23)22-18(16-17-10-6-4-7-11-17)14-15-27(24,25)19-12-8-5-9-13-19/h4-15,18H,16H2,1-3H3,(H,22,23)/b15-14+/t18-/m1/s1.
What are the key properties of tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate?
tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate has a molecular weight of 387.50 g/mol, XLogP of 4.11, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(E,2S)-4-(benzenesulfonyl)-1-phenylbut-3-en-2-yl]carbamate is sourced from PubChem (CID 10862018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).