C23H21FN4O — CID 10862033
4-(2-fluorophenyl)-12-(2-phenylethyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one (PubChem CID 10862033) has the molecular formula C23H21FN4O and a molecular weight of 388.45 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-12-(2-phenylethyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one.
| Compound Name | 4-(2-fluorophenyl)-12-(2-phenylethyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
|---|---|
| PubChem CID | 10862033 |
| Molecular Formula | C23H21FN4O |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 4-(2-fluorophenyl)-12-(2-phenylethyl)-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
| SMILES | O=c1[nH]c2c(c3nc(-c4ccccc4F)cn13)CN(CCc1ccccc1)CC2 |
| InChI | InChI=1S/C23H21FN4O/c24-19-9-5-4-8-17(19)21-15-28-22(25-21)18-14-27(13-11-20(18)26-23(28)29)12-10-16-6-2-1-3-7-16/h1-9,15H,10-14H2,(H,26,29) |
| InChIKey | UALAJNVQEVLARC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |