C20H40O5Si — CID 10862054
(3S,4R,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-6-(methoxymethoxy)-3,5-dimethylnon-8-en-2-one (PubChem CID 10862054) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is (3S,4R,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-6-(methoxymethoxy)-3,5-dimethylnon-8-en-2-one.
| Compound Name | (3S,4R,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-6-(methoxymethoxy)-3,5-dimethylnon-8-en-2-one |
|---|---|
| PubChem CID | 10862054 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (3S,4R,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-6-(methoxymethoxy)-3,5-dimethylnon-8-en-2-one |
| SMILES | C=C[C@H](OC)[C@H](OCOC)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(C)=O |
| InChI | InChI=1S/C20H40O5Si/c1-12-17(23-9)19(24-13-22-8)15(3)18(14(2)16(4)21)25-26(10,11)20(5,6)7/h12,14-15,17-19H,1,13H2,2-11H3/t14-,15+,17+,18+,19-/m1/s1 |
| InChIKey | KDNBHTDBPDONSE-ZDMKNRLGSA-N |
| XLogP | 4.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|