C25H31NOSi — CID 10862074
(1R,5R,8R)-8-[benzhydryl(dimethyl)silyl]-6-propan-2-yl-6-azabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 10862074) has the molecular formula C25H31NOSi and a molecular weight of 389.62 g/mol. Its IUPAC name is (1R,5R,8R)-8-[benzhydryl(dimethyl)silyl]-6-propan-2-yl-6-azabicyclo[3.2.1]oct-3-en-7-one.
| Compound Name | (1R,5R,8R)-8-[benzhydryl(dimethyl)silyl]-6-propan-2-yl-6-azabicyclo[3.2.1]oct-3-en-7-one |
|---|---|
| PubChem CID | 10862074 |
| Molecular Formula | C25H31NOSi |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (1R,5R,8R)-8-[benzhydryl(dimethyl)silyl]-6-propan-2-yl-6-azabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | CC(C)N1C(=O)[C@H]2CC=C[C@@H]1[C@@H]2[Si](C)(C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31NOSi/c1-18(2)26-22-17-11-16-21(25(26)27)24(22)28(3,4)23(19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-15,17-18,21-24H,16H2,1-4H3/t21-,22+,24+/m0/s1 |
| InChIKey | AVJBDXOJESATNZ-WMTXJRDZSA-N |
| XLogP | 5.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|