C21H33NO4Si — CID 10862109
(4R)-3-benzyl-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4-methyl-1,3-oxazolidine-2,5-dione (PubChem CID 10862109) has the molecular formula C21H33NO4Si and a molecular weight of 391.58 g/mol. Its IUPAC name is (4R)-3-benzyl-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4-methyl-1,3-oxazolidine-2,5-dione.
| Compound Name | (4R)-3-benzyl-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4-methyl-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 10862109 |
| Molecular Formula | C21H33NO4Si |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | (4R)-3-benzyl-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]-4-methyl-1,3-oxazolidine-2,5-dione |
| SMILES | CC(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@]1(C)C(=O)OC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H33NO4Si/c1-15(2)17(26-27(7,8)20(3,4)5)21(6)18(23)25-19(24)22(21)14-16-12-10-9-11-13-16/h9-13,15,17H,14H2,1-8H3/t17-,21+/m0/s1 |
| InChIKey | INMCOSADGLYTJL-LAUBAEHRSA-N |
| XLogP | 4.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|