About 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione
3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione (PubChem CID 10862127) has the molecular formula C25H28O4
and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione.
Molecular Properties
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione |
| PubChem CID | 10862127 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione |
| SMILES | Cc1cccc2c1C(=O)C(=O)C(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)=C2O |
| InChI | InChI=1S/C25H28O4/c1-13-9-8-10-15-18(13)22(28)23(29)19(20(15)26)14-11-16(24(2,3)4)21(27)17(12-14)25(5,6)7/h8-12,26-27H,1-7H3 |
| InChIKey | ZHQOLYKRMNLSJV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione?
The IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione (CID 10862127) is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione.
What is the SMILES notation for 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione?
The canonical SMILES for 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione is Cc1cccc2c1C(=O)C(=O)C(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)=C2O.
What is the InChIKey of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione?
The InChIKey is ZHQOLYKRMNLSJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28O4/c1-13-9-8-10-15-18(13)22(28)23(29)19(20(15)26)14-11-16(24(2,3)4)21(27)17(12-14)25(5,6)7/h8-12,26-27H,1-7H3.
What are the key properties of 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione?
3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione has a molecular weight of 392.50 g/mol, XLogP of 5.49, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-8-methylnaphthalene-1,2-dione is sourced from PubChem (CID 10862127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).