C18H31BrO3Si — CID 10862333
(2R,5S)-5-[(2R,3S)-3-(2-bromoprop-2-enyl)oxiran-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-methylidenepentanal (PubChem CID 10862333) has the molecular formula C18H31BrO3Si and a molecular weight of 403.43 g/mol. Its IUPAC name is (2R,5S)-5-[(2R,3S)-3-(2-bromoprop-2-enyl)oxiran-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-methylidenepentanal.
| Compound Name | (2R,5S)-5-[(2R,3S)-3-(2-bromoprop-2-enyl)oxiran-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-methylidenepentanal |
|---|---|
| PubChem CID | 10862333 |
| Molecular Formula | C18H31BrO3Si |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (2R,5S)-5-[(2R,3S)-3-(2-bromoprop-2-enyl)oxiran-2-yl]-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-methylidenepentanal |
| SMILES | C=C(Br)C[C@@H]1O[C@H]1[C@H](CC(=C)[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H31BrO3Si/c1-12(13(2)11-20)9-16(17-15(21-17)10-14(3)19)22-23(7,8)18(4,5)6/h11,13,15-17H,1,3,9-10H2,2,4-8H3/t13-,15-,16-,17+/m0/s1 |
| InChIKey | XTEYVPLPLVDRDX-QSPRXWTASA-N |
| XLogP | 5.22 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|