C24H26N2O4 — CID 10862396
4-(3,4-dimethoxyphenyl)-2-phenacyl-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 10862396) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-phenacyl-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-phenacyl-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 10862396 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-phenacyl-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(CC(=O)c3ccccc3)C(=O)C3CCCCC23)cc1OC |
| InChI | InChI=1S/C24H26N2O4/c1-29-21-13-12-17(14-22(21)30-2)23-18-10-6-7-11-19(18)24(28)26(25-23)15-20(27)16-8-4-3-5-9-16/h3-5,8-9,12-14,18-19H,6-7,10-11,15H2,1-2H3 |
| InChIKey | HMKJSFGZWJJYNY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |