About bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate
bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate (PubChem CID 10862397) has the molecular formula C18H21F3O3S2
and a molecular weight of 406.49 g/mol. Its IUPAC name is bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate |
| PubChem CID | 10862397 |
| Molecular Formula | C18H21F3O3S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate |
| SMILES | Cc1ccc(C)c([S+](C)c2cc(C)ccc2C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C17H21S.CHF3O3S/c1-12-6-8-14(3)16(10-12)18(5)17-11-13(2)7-9-15(17)4;2-1(3,4)8(5,6)7/h6-11H,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | NYNKDNAYXLVTPE-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate?
The IUPAC name of bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate (CID 10862397) is bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate.
What is the SMILES notation for bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate?
The canonical SMILES for bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate is Cc1ccc(C)c([S+](C)c2cc(C)ccc2C)c1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate?
The InChIKey is NYNKDNAYXLVTPE-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H21S.CHF3O3S/c1-12-6-8-14(3)16(10-12)18(5)17-11-13(2)7-9-15(17)4;2-1(3,4)8(5,6)7/h6-11H,1-5H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate?
bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate has a molecular weight of 406.49 g/mol, XLogP of 4.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,5-dimethylphenyl)-methylsulfanium;trifluoromethanesulfonate is sourced from PubChem (CID 10862397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).