C21H23NO5S — CID 108624235
(4E)-1-butyl-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108624235) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is (4E)-1-butyl-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-butyl-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108624235 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (4E)-1-butyl-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | CCCCN1C(=O)C(=O)/C(=C(/O)c2c(OC)cccc2OC)C1c1cccs1 |
| InChI | InChI=1S/C21H23NO5S/c1-4-5-11-22-18(15-10-7-12-28-15)17(20(24)21(22)25)19(23)16-13(26-2)8-6-9-14(16)27-3/h6-10,12,18,23H,4-5,11H2,1-3H3/b19-17+ |
| InChIKey | KVQZTVUPQMBKDU-HTXNQAPBSA-N |
| XLogP | 3.99 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|