C26H24FNO4S — CID 108624702
(4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-(4-methoxy-3-propan-2-ylphenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108624702) has the molecular formula C26H24FNO4S and a molecular weight of 465.55 g/mol. Its IUPAC name is (4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-(4-methoxy-3-propan-2-ylphenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-(4-methoxy-3-propan-2-ylphenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108624702 |
| Molecular Formula | C26H24FNO4S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-(4-methoxy-3-propan-2-ylphenyl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(Cc3ccc(F)cc3)C2c2cccs2)cc1C(C)C |
| InChI | InChI=1S/C26H24FNO4S/c1-15(2)19-13-17(8-11-20(19)32-3)24(29)22-23(21-5-4-12-33-21)28(26(31)25(22)30)14-16-6-9-18(27)10-7-16/h4-13,15,23,29H,14H2,1-3H3/b24-22- |
| InChIKey | SWRNPMRWKIQMBH-GYHWCHFESA-N |
| XLogP | 5.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|