C24H46O3Si — CID 10862501
(5E,8R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-14-pentyl-1-oxacyclotetradec-5-en-2-one (PubChem CID 10862501) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is (5E,8R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-14-pentyl-1-oxacyclotetradec-5-en-2-one.
| Compound Name | (5E,8R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-14-pentyl-1-oxacyclotetradec-5-en-2-one |
|---|---|
| PubChem CID | 10862501 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | (5E,8R,14R)-8-[tert-butyl(dimethyl)silyl]oxy-14-pentyl-1-oxacyclotetradec-5-en-2-one |
| SMILES | CCCCC[C@@H]1CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)C/C=C/CCC(=O)O1 |
| InChI | InChI=1S/C24H46O3Si/c1-7-8-11-16-21-17-12-9-13-18-22(27-28(5,6)24(2,3)4)19-14-10-15-20-23(25)26-21/h10,14,21-22H,7-9,11-13,15-20H2,1-6H3/b14-10+/t21-,22-/m1/s1 |
| InChIKey | AXXCVZKXIVIVLR-VKMFJKSESA-N |
| XLogP | 7.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|