C24H16FN3O3 — CID 108626797
4-[(4Z)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzonitrile (PubChem CID 108626797) has the molecular formula C24H16FN3O3 and a molecular weight of 413.41 g/mol. Its IUPAC name is 4-[(4Z)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4Z)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108626797 |
| Molecular Formula | C24H16FN3O3 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-[(4Z)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]benzonitrile |
| SMILES | Cc1cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C#N)cc3)C2c2ccccn2)ccc1F |
| InChI | InChI=1S/C24H16FN3O3/c1-14-12-16(7-10-18(14)25)22(29)20-21(19-4-2-3-11-27-19)28(24(31)23(20)30)17-8-5-15(13-26)6-9-17/h2-12,21,29H,1H3/b22-20- |
| InChIKey | ADSSENWOJDFZMI-XDOYNYLZSA-N |
| XLogP | 4.03 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|