C20H18N2O5S — CID 10862709
5-[[4-[2-(4-oxo-1H-2,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10862709) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is 5-[[4-[2-(4-oxo-1H-2,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(4-oxo-1H-2,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10862709 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 5-[[4-[2-(4-oxo-1H-2,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCCN3OCc4ccccc4C3=O)cc2)S1 |
| InChI | InChI=1S/C20H18N2O5S/c23-18-17(28-20(25)21-18)11-13-5-7-15(8-6-13)26-10-9-22-19(24)16-4-2-1-3-14(16)12-27-22/h1-8,17H,9-12H2,(H,21,23,25) |
| InChIKey | GMLMDFUMTKVQKN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|