C18H32O9Si — CID 10862718
[(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxyoxan-3-yl] acetate (PubChem CID 10862718) has the molecular formula C18H32O9Si and a molecular weight of 420.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 10862718 |
| Molecular Formula | C18H32O9Si |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)C(O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O9Si/c1-10(19)24-14-13(9-23-28(7,8)18(4,5)6)27-17(22)16(26-12(3)21)15(14)25-11(2)20/h13-17,22H,9H2,1-8H3/t13-,14-,15+,16-,17?/m1/s1 |
| InChIKey | JGJHZUOUOGFYKK-VDWCLKJHSA-N |
| XLogP | 1.52 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|