C23H24Cl2N2O5 — CID 108628187
(4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(3-propan-2-yloxypropyl)-5-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 108628187) has the molecular formula C23H24Cl2N2O5 and a molecular weight of 479.36 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(3-propan-2-yloxypropyl)-5-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(3-propan-2-yloxypropyl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108628187 |
| Molecular Formula | C23H24Cl2N2O5 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(3-propan-2-yloxypropyl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(CCCOC(C)C)C2c2ccccn2)cc1Cl |
| InChI | InChI=1S/C23H24Cl2N2O5/c1-13(2)32-10-6-9-27-19(17-7-4-5-8-26-17)18(21(29)23(27)30)20(28)14-11-15(24)22(31-3)16(25)12-14/h4-5,7-8,11-13,19,28H,6,9-10H2,1-3H3/b20-18+ |
| InChIKey | OLXPRNVGZRBUJT-CZIZESTLSA-N |
| XLogP | 4.63 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|