C23H44O5Si — CID 10862889
(2R,5aR,6R,9aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2-ethoxyethoxy)propyl]-4,5,5a,6,7,8,9,9a-octahydrobenzo[b]oxepin-3-one (PubChem CID 10862889) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is (2R,5aR,6R,9aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2-ethoxyethoxy)propyl]-4,5,5a,6,7,8,9,9a-octahydrobenzo[b]oxepin-3-one.
| Compound Name | (2R,5aR,6R,9aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2-ethoxyethoxy)propyl]-4,5,5a,6,7,8,9,9a-octahydrobenzo[b]oxepin-3-one |
|---|---|
| PubChem CID | 10862889 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | (2R,5aR,6R,9aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2-ethoxyethoxy)propyl]-4,5,5a,6,7,8,9,9a-octahydrobenzo[b]oxepin-3-one |
| SMILES | CCOCCOCCC[C@H]1O[C@H]2CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CCC1=O |
| InChI | InChI=1S/C23H44O5Si/c1-7-25-16-17-26-15-9-12-22-19(24)14-13-18-20(27-22)10-8-11-21(18)28-29(5,6)23(2,3)4/h18,20-22H,7-17H2,1-6H3/t18-,20+,21-,22-/m1/s1 |
| InChIKey | GOOXZCWRANOACO-FVTFTPSCSA-N |
| XLogP | 5.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|