C23H17FN2O4 — CID 108629313
(4Z)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108629313) has the molecular formula C23H17FN2O4 and a molecular weight of 404.40 g/mol. Its IUPAC name is (4Z)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108629313 |
| Molecular Formula | C23H17FN2O4 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (4Z)-4-[(4-fluoro-3-methylphenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2/C(=O)C(=O)N(c3ccccc3O)C2c2cccnc2)ccc1F |
| InChI | InChI=1S/C23H17FN2O4/c1-13-11-14(8-9-16(13)24)21(28)19-20(15-5-4-10-25-12-15)26(23(30)22(19)29)17-6-2-3-7-18(17)27/h2-12,20,27-28H,1H3/b21-19- |
| InChIKey | XDNLHDMHPWNKKF-VZCXRCSSSA-N |
| XLogP | 3.86 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|