C25H40O3Si2 — CID 10863183
(5R,6R)-5-[(Z)-hex-3-en-1,5-diynyl]-5,6-bis(triethylsilyloxy)cyclohexene-1-carbaldehyde (PubChem CID 10863183) has the molecular formula C25H40O3Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is (5R,6R)-5-[(Z)-hex-3-en-1,5-diynyl]-5,6-bis(triethylsilyloxy)cyclohexene-1-carbaldehyde.
| Compound Name | (5R,6R)-5-[(Z)-hex-3-en-1,5-diynyl]-5,6-bis(triethylsilyloxy)cyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 10863183 |
| Molecular Formula | C25H40O3Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (5R,6R)-5-[(Z)-hex-3-en-1,5-diynyl]-5,6-bis(triethylsilyloxy)cyclohexene-1-carbaldehyde |
| SMILES | C#C/C=C\C#C[C@]1(O[Si](CC)(CC)CC)CCC=C(C=O)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H40O3Si2/c1-8-15-16-17-20-25(28-30(12-5,13-6)14-7)21-18-19-23(22-26)24(25)27-29(9-2,10-3)11-4/h1,15-16,19,22,24H,9-14,18,21H2,2-7H3/b16-15-/t24-,25+/m1/s1 |
| InChIKey | PLNVLRWKBHNSKZ-DGTJDLLCSA-N |
| XLogP | 6.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|