C27H46O3Si — CID 10863238
tert-butyl-[[(1S,3S,5S,8S,9E,11R)-5-(methoxymethoxy)-8,15,15-trimethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadeca-9,13-dienyl]oxy]-dimethylsilane (PubChem CID 10863238) has the molecular formula C27H46O3Si and a molecular weight of 446.75 g/mol. Its IUPAC name is tert-butyl-[[(1S,3S,5S,8S,9E,11R)-5-(methoxymethoxy)-8,15,15-trimethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadeca-9,13-dienyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,3S,5S,8S,9E,11R)-5-(methoxymethoxy)-8,15,15-trimethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadeca-9,13-dienyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10863238 |
| Molecular Formula | C27H46O3Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | tert-butyl-[[(1S,3S,5S,8S,9E,11R)-5-(methoxymethoxy)-8,15,15-trimethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadeca-9,13-dienyl]oxy]-dimethylsilane |
| SMILES | C=C1[C@@H](OCOC)CC[C@@]2(C)/C=C\[C@H]3CC=C(O[Si](C)(C)C(C)(C)C)[C@@H](C[C@H]12)C3(C)C |
| InChI | InChI=1S/C27H46O3Si/c1-19-21-17-22-24(30-31(9,10)25(2,3)4)12-11-20(26(22,5)6)13-15-27(21,7)16-14-23(19)29-18-28-8/h12-13,15,20-23H,1,11,14,16-18H2,2-10H3/b15-13-/t20-,21-,22-,23+,27-/m1/s1 |
| InChIKey | CQDPGSRFDSITNY-VESGVPPGSA-N |
| XLogP | 7.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|