C22H15FN2O4 — CID 108632796
(4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-pyridin-4-ylpyrrolidine-2,3-dione (PubChem CID 108632796) has the molecular formula C22H15FN2O4 and a molecular weight of 390.37 g/mol. Its IUPAC name is (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-pyridin-4-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-pyridin-4-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108632796 |
| Molecular Formula | C22H15FN2O4 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (4E)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(2-hydroxyphenyl)-5-pyridin-4-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccccc2O)C(c2ccncc2)/C1=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H15FN2O4/c23-15-7-5-14(6-8-15)20(27)18-19(13-9-11-24-12-10-13)25(22(29)21(18)28)16-3-1-2-4-17(16)26/h1-12,19,26-27H/b20-18+ |
| InChIKey | SLMPBIMMXHMVGW-CZIZESTLSA-N |
| XLogP | 3.55 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|