C22H46NO7P — CID 10863604
[(2R)-3-[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] 2,12-dimethyltridecanoate (PubChem CID 10863604) has the molecular formula C22H46NO7P and a molecular weight of 467.58 g/mol. Its IUPAC name is [(2R)-3-[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] 2,12-dimethyltridecanoate.
| Compound Name | [(2R)-3-[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] 2,12-dimethyltridecanoate |
|---|---|
| PubChem CID | 10863604 |
| Molecular Formula | C22H46NO7P |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | [(2R)-3-[2-(dimethylamino)ethoxy-hydroxyphosphoryl]oxy-2-hydroxypropyl] 2,12-dimethyltridecanoate |
| SMILES | CC(C)CCCCCCCCCC(C)C(=O)OC[C@@H](O)COP(=O)(O)OCCN(C)C |
| InChI | InChI=1S/C22H46NO7P/c1-19(2)13-11-9-7-6-8-10-12-14-20(3)22(25)28-17-21(24)18-30-31(26,27)29-16-15-23(4)5/h19-21,24H,6-18H2,1-5H3,(H,26,27)/t20?,21-/m1/s1 |
| InChIKey | QELXTHOSRJYIIN-BPGUCPLFSA-N |
| XLogP | 4.39 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|