C29H46O3Si — CID 10863661
(1R,2S,4E,5R,6R,7S)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-4-pent-2-ynylidenetricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 10863661) has the molecular formula C29H46O3Si and a molecular weight of 470.77 g/mol. Its IUPAC name is (1R,2S,4E,5R,6R,7S)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-4-pent-2-ynylidenetricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,4E,5R,6R,7S)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-4-pent-2-ynylidenetricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 10863661 |
| Molecular Formula | C29H46O3Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (1R,2S,4E,5R,6R,7S)-5-[8-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-4-pent-2-ynylidenetricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CCC#C/C=C1/C(=O)[C@@H]2[C@@H]([C@@H]3C=C[C@H]2C3)[C@]1(O)CCCCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H46O3Si/c1-7-8-13-16-24-27(30)25-22-17-18-23(21-22)26(25)29(24,31)19-14-11-9-10-12-15-20-32-33(5,6)28(2,3)4/h16-18,22-23,25-26,31H,7,9-12,14-15,19-21H2,1-6H3/b24-16-/t22-,23+,25-,26+,29-/m0/s1 |
| InChIKey | IQIZMKNTTFBBCP-HRQULIEKSA-N |
| XLogP | 6.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|