C18H16ClNO4S — CID 108637228
2-(3-chloro-4-hydroxyphenyl)-4-hydroxy-1-propyl-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 108637228) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is 2-(3-chloro-4-hydroxyphenyl)-4-hydroxy-1-propyl-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 2-(3-chloro-4-hydroxyphenyl)-4-hydroxy-1-propyl-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108637228 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-(3-chloro-4-hydroxyphenyl)-4-hydroxy-1-propyl-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCN1C(=O)C(O)=C(C(=O)c2cccs2)C1c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClNO4S/c1-2-7-20-15(10-5-6-12(21)11(19)9-10)14(17(23)18(20)24)16(22)13-4-3-8-25-13/h3-6,8-9,15,21,23H,2,7H2,1H3 |
| InChIKey | HYLIBOJCWHKZPH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |