C27H50O5Si — CID 10863808
butyl 2-[(4R,6R)-6-[(1E,3E,8R)-8-[tert-butyl(dimethyl)silyl]oxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 10863808) has the molecular formula C27H50O5Si and a molecular weight of 482.78 g/mol. Its IUPAC name is butyl 2-[(4R,6R)-6-[(1E,3E,8R)-8-[tert-butyl(dimethyl)silyl]oxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | butyl 2-[(4R,6R)-6-[(1E,3E,8R)-8-[tert-butyl(dimethyl)silyl]oxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 10863808 |
| Molecular Formula | C27H50O5Si |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | butyl 2-[(4R,6R)-6-[(1E,3E,8R)-8-[tert-butyl(dimethyl)silyl]oxynona-1,3-dienyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CCCCOC(=O)C[C@H]1C[C@H](/C=C/C=C/CCC[C@@H](C)O[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C27H50O5Si/c1-10-11-19-29-25(28)21-24-20-23(30-27(6,7)31-24)18-16-14-12-13-15-17-22(2)32-33(8,9)26(3,4)5/h12,14,16,18,22-24H,10-11,13,15,17,19-21H2,1-9H3/b14-12+,18-16+/t22-,23+,24-/m1/s1 |
| InChIKey | UOQOZRIEDHCLCE-TUWWCLQMSA-N |
| XLogP | 7.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|