C25H20BrNO3 — CID 108638360
(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-5-phenylpyrrolidine-2,3-dione (PubChem CID 108638360) has the molecular formula C25H20BrNO3 and a molecular weight of 462.34 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-5-phenylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108638360 |
| Molecular Formula | C25H20BrNO3 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-5-phenylpyrrolidine-2,3-dione |
| SMILES | CCc1ccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(Br)cc3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20BrNO3/c1-2-16-8-14-20(15-9-16)27-22(17-6-4-3-5-7-17)21(24(29)25(27)30)23(28)18-10-12-19(26)13-11-18/h3-15,22,28H,2H2,1H3/b23-21+ |
| InChIKey | METUEGDQUWZBDA-XTQSDGFTSA-N |
| XLogP | 5.64 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|