C22H14N2O3S — CID 108639435
4-[4-hydroxy-5-oxo-2-phenyl-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]benzonitrile (PubChem CID 108639435) has the molecular formula C22H14N2O3S and a molecular weight of 386.43 g/mol. Its IUPAC name is 4-[4-hydroxy-5-oxo-2-phenyl-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]benzonitrile.
| Compound Name | 4-[4-hydroxy-5-oxo-2-phenyl-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108639435 |
| Molecular Formula | C22H14N2O3S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 4-[4-hydroxy-5-oxo-2-phenyl-3-(thiophene-2-carbonyl)-2H-pyrrol-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C(O)=C(C(=O)c3cccs3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H14N2O3S/c23-13-14-8-10-16(11-9-14)24-19(15-5-2-1-3-6-15)18(21(26)22(24)27)20(25)17-7-4-12-28-17/h1-12,19,26H |
| InChIKey | FDVSZBIWMFSTEH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |