C35H37NO2 — CID 10864061
(8R,9S,10R,13S,14S)-10,13-dimethyl-3-[2-(3-methylphenyl)-1H-indole-3-carbonyl]-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (PubChem CID 10864061) has the molecular formula C35H37NO2 and a molecular weight of 503.69 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-3-[2-(3-methylphenyl)-1H-indole-3-carbonyl]-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-3-[2-(3-methylphenyl)-1H-indole-3-carbonyl]-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 10864061 |
| Molecular Formula | C35H37NO2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-3-[2-(3-methylphenyl)-1H-indole-3-carbonyl]-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| SMILES | Cc1cccc(-c2[nH]c3ccccc3c2C(=O)C2=CC3=CC[C@@H]4[C@H](CC[C@]5(C)C(=O)CC[C@@H]45)[C@@]3(C)CC2)c1 |
| InChI | InChI=1S/C35H37NO2/c1-21-7-6-8-22(19-21)32-31(26-9-4-5-10-29(26)36-32)33(38)23-15-17-34(2)24(20-23)11-12-25-27-13-14-30(37)35(27,3)18-16-28(25)34/h4-11,19-20,25,27-28,36H,12-18H2,1-3H3/t25-,27-,28-,34-,35-/m0/s1 |
| InChIKey | MANBQJSPJBAGLH-WXGYWSNNSA-N |
| XLogP | 8.39 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |