C25H48O8Si — CID 10864075
[(4R,4aR,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10864075) has the molecular formula C25H48O8Si and a molecular weight of 504.74 g/mol. Its IUPAC name is [(4R,4aR,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(4R,4aR,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10864075 |
| Molecular Formula | C25H48O8Si |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | [(4R,4aR,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1[C@H]2OCO[C@H](COC(=O)C(C)(C)C)[C@H]2O[C@H](C[C@H](O)CO[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C25H48O8Si/c1-23(2,3)22(27)29-14-17-19-20(31-15-30-17)21(28-9)25(7,8)18(33-19)12-16(26)13-32-34(10,11)24(4,5)6/h16-21,26H,12-15H2,1-11H3/t16-,17+,18+,19+,20-,21+/m0/s1 |
| InChIKey | YMFCWZVPGITOJT-LDIYZUBKSA-N |
| XLogP | 3.90 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|