C23H23NO4 — CID 108640827
(4Z)-1-cyclopentyl-4-[hydroxy-(2-methoxyphenyl)methylidene]-5-phenylpyrrolidine-2,3-dione (PubChem CID 108640827) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is (4Z)-1-cyclopentyl-4-[hydroxy-(2-methoxyphenyl)methylidene]-5-phenylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-cyclopentyl-4-[hydroxy-(2-methoxyphenyl)methylidene]-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108640827 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (4Z)-1-cyclopentyl-4-[hydroxy-(2-methoxyphenyl)methylidene]-5-phenylpyrrolidine-2,3-dione |
| SMILES | COc1ccccc1/C(O)=C1/C(=O)C(=O)N(C2CCCC2)C1c1ccccc1 |
| InChI | InChI=1S/C23H23NO4/c1-28-18-14-8-7-13-17(18)21(25)19-20(15-9-3-2-4-10-15)24(23(27)22(19)26)16-11-5-6-12-16/h2-4,7-10,13-14,16,20,25H,5-6,11-12H2,1H3/b21-19- |
| InChIKey | WNIFDLCTGRPJLQ-VZCXRCSSSA-N |
| XLogP | 4.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|