C28H25N3O4 — CID 108641052
(4E)-1-(1H-benzimidazol-2-yl)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-phenylpyrrolidine-2,3-dione (PubChem CID 108641052) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is (4E)-1-(1H-benzimidazol-2-yl)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-phenylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108641052 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-phenylpyrrolidine-2,3-dione |
| SMILES | CC(C)COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccccc4[nH]3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25N3O4/c1-17(2)16-35-20-14-12-19(13-15-20)25(32)23-24(18-8-4-3-5-9-18)31(27(34)26(23)33)28-29-21-10-6-7-11-22(21)30-28/h3-15,17,24,32H,16H2,1-2H3,(H,29,30)/b25-23+ |
| InChIKey | NQFKQMLLCYKCGZ-WJTDDFOZSA-N |
| XLogP | 5.22 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|